| Compound Information | SONAR Target prediction | | Name: | | | Unique Identifier: | 2188-2621 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C19H16O6 | | Molecular Weight: | 324.2 g/mol | | X log p: | 11.322 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1Oc2cc(O)cc(O)c2C(=O)C=1c1ccc2OCCCOc2c1 |
| Species: |
4932 |
| Condition: |
tep1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7650±0.140361 |
| Normalized OD Score: sc h |
0.9719±0.00784546 |
| Z-Score: |
-0.6575±0.220723 |
| p-Value: |
0.516002 |
| Z-Factor: |
-7.64956 |
| Fitness Defect: |
0.6616 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | ChemDiv-Kinase | | Plate Number and Position: | 3|A5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-16 YYYY-MM-DD | | Plate CH Control (+): | 0.042825±0.00181 | | Plate DMSO Control (-): | 0.708575±0.03514 | | Plate Z-Factor: | 0.8226 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5394360 |
3-(2,6-dioxabicyclo[5.4.0]undeca-8,10,12-trien-10-yl)-5,7-dihydroxy-2-methyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 7962 | Additional Members: 5 | Rows returned: 0 | |
|
