| Compound Information | SONAR Target prediction |
| Name: | |
| Unique Identifier: | 1187-0475 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C19H17N3O4 |
| Molecular Weight: | 334.221 g/mol |
| X log p: | 14.371 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 52.41 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | COc1ccc(c(O)c1)c1nc(N)ncc1c1ccc2OCCOc2c1 |
| Found: 3 nonactive as graph: single | with analogs | << Back 1 2 3 Next >> |
| Species: | 4932 |
| Condition: | rpl9-2nd |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6338±0.0033234 |
| Normalized OD Score: sc h | 0.9704±0.001708 |
| Z-Score: | -0.9289±0.0120097 |
| p-Value: | 0.352962 |
| Z-Factor: | -1.8964 |
| Fitness Defect: | 1.0414 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 7962 | Additional Members: 5 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory