| Compound Information | SONAR Target prediction |  | Name: |  |  | Unique Identifier: | 1075-0001  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C10H13N5O3 |  | Molecular Weight: | 238.139 g/mol |  | X log p: | 2.791  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 49.55 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | Nc1ncnc2n(cnc12)C1CC(O)C(CO)O1 |  | Generic_name: | 2--DEOXYADENOSINE |  | Chemical_iupac_name: | 5-(6-AMINO-PURIN-9-YL)-2-HYDROXYMETHYL-TETRAHYDRO-FURAN-3-OL |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT00166 |  | Logp: | -1.08 |  | Drug_category: | Purine Trans Deoxyribosylase inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		tep1-2nd | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7687±0.0610233 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0689±0.020814 | 
	 
	
		| Z-Score: | 
		1.5851±0.388313 | 
	 
	
		| p-Value: | 
		0.126482 | 
	 
	
		| Z-Factor: | 
		-1.78742 | 
	 
	
		| Fitness Defect: | 
		2.0677 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | ChemDiv-Kinase |  | Plate Number and Position: | 2|E8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2005-08-16 YYYY-MM-DD |  | Plate CH Control (+): | 0.042300000000000004±0.00209 |  | Plate DMSO Control (-): | 0.6331249999999999±0.02790 |  | Plate Z-Factor: | 0.8335 |  
  |  png ps pdf |  
 
 
	
		| 636 | 
		5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 13730 | 
		(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 72246 | 
		(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 453553 | 
		(2S,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 489519 | 
		(2S,3R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
	
		| 6541020 | 
		(2R,3R,5S)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 
 
 |