| Compound Information | SONAR Target prediction |
| Name: | |
| Unique Identifier: | 000A-0229 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C12H15N3O4S |
| Molecular Weight: | 282.212 g/mol |
| X log p: | 5.098 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 81.18 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 6 |
| Canonical Smiles: | CCCS(=O)(=O)c1ccc2nc(NC(=O)OC)nc2c1 |
| Found: 3 nonactive as graph: single | with analogs | << Back 1 2 3 Next >> |
| Species: | 4932 |
| Condition: | rpl9-2nd |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6890±0.0329512 |
| Normalized OD Score: sc h | 1.0326±0.00649186 |
| Z-Score: | 1.0279±0.249823 |
| p-Value: | 0.3115 |
| Z-Factor: | -2.84144 |
| Fitness Defect: | 1.1664 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 3124 | Additional Members: 12 | Rows returned: 5 |
| Prest1273 | 0.491803278688525 |
| LOPAC 01029 | 0.370967741935484 |
| LAT002F08 | 0 |
| SPE01501110 | 0 |
| Prest310 | 0 |
Service provided by the
Mike Tyers Laboratory